C12H20NO3P — CID 130623996
[1-(benzylamino)-2,2-dimethylpropyl]phosphonic acid (PubChem CID 130623996) has the molecular formula C12H20NO3P and a molecular weight of 257.27 g/mol. Its IUPAC name is [1-(benzylamino)-2,2-dimethylpropyl]phosphonic acid.
| Compound Name | [1-(benzylamino)-2,2-dimethylpropyl]phosphonic acid |
|---|---|
| PubChem CID | 130623996 |
| Molecular Formula | C12H20NO3P |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [1-(benzylamino)-2,2-dimethylpropyl]phosphonic acid |
| SMILES | CC(C)(C)C(NCc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C12H20NO3P/c1-12(2,3)11(17(14,15)16)13-9-10-7-5-4-6-8-10/h4-8,11,13H,9H2,1-3H3,(H2,14,15,16) |
| InChIKey | IRCUPRZOQOGXTA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|