C19H26NO2P — CID 949709
[(1S)-1-(benzylamino)-2-methylpropyl]-(2-phenylethyl)phosphinic acid (PubChem CID 949709) has the molecular formula C19H26NO2P and a molecular weight of 331.40 g/mol. Its IUPAC name is [(1S)-1-(benzylamino)-2-methylpropyl]-(2-phenylethyl)phosphinic acid.
| Compound Name | [(1S)-1-(benzylamino)-2-methylpropyl]-(2-phenylethyl)phosphinic acid |
|---|---|
| PubChem CID | 949709 |
| Molecular Formula | C19H26NO2P |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | [(1S)-1-(benzylamino)-2-methylpropyl]-(2-phenylethyl)phosphinic acid |
| SMILES | CC(C)[C@@H](NCc1ccccc1)P(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C19H26NO2P/c1-16(2)19(20-15-18-11-7-4-8-12-18)23(21,22)14-13-17-9-5-3-6-10-17/h3-12,16,19-20H,13-15H2,1-2H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | JOJGDPRZXONZIQ-IBGZPJMESA-N |
| XLogP | 4.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|