C17H20NO4P — CID 7079116
3-[[(S)-(benzylamino)-phenylmethyl]-hydroxyphosphoryl]propanoic acid (PubChem CID 7079116) has the molecular formula C17H20NO4P and a molecular weight of 333.32 g/mol. Its IUPAC name is 3-[[(S)-(benzylamino)-phenylmethyl]-hydroxyphosphoryl]propanoic acid.
| Compound Name | 3-[[(S)-(benzylamino)-phenylmethyl]-hydroxyphosphoryl]propanoic acid |
|---|---|
| PubChem CID | 7079116 |
| Molecular Formula | C17H20NO4P |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 3-[[(S)-(benzylamino)-phenylmethyl]-hydroxyphosphoryl]propanoic acid |
| SMILES | O=C(O)CCP(=O)(O)[C@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20NO4P/c19-16(20)11-12-23(21,22)17(15-9-5-2-6-10-15)18-13-14-7-3-1-4-8-14/h1-10,17-18H,11-13H2,(H,19,20)(H,21,22)/t17-/m0/s1 |
| InChIKey | PCJXXQULYWFRDT-KRWDZBQOSA-N |
| XLogP | 3.22 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|