C26H30N3O7P — CID 135055739
(1R)-N-benzyl-1-[bis[(2-nitrophenyl)methoxy]phosphoryl]-2,2-dimethylpropan-1-amine (PubChem CID 135055739) has the molecular formula C26H30N3O7P and a molecular weight of 527.51 g/mol. Its IUPAC name is (1R)-N-benzyl-1-[bis[(2-nitrophenyl)methoxy]phosphoryl]-2,2-dimethylpropan-1-amine.
| Compound Name | (1R)-N-benzyl-1-[bis[(2-nitrophenyl)methoxy]phosphoryl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 135055739 |
| Molecular Formula | C26H30N3O7P |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | (1R)-N-benzyl-1-[bis[(2-nitrophenyl)methoxy]phosphoryl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@H](NCc1ccccc1)P(=O)(OCc1ccccc1[N+](=O)[O-])OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N3O7P/c1-26(2,3)25(27-17-20-11-5-4-6-12-20)37(34,35-18-21-13-7-9-15-23(21)28(30)31)36-19-22-14-8-10-16-24(22)29(32)33/h4-16,25,27H,17-19H2,1-3H3/t25-/m1/s1 |
| InChIKey | BSWJEQQCLMIQJN-RUZDIDTESA-N |
| XLogP | 6.59 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|