C13H15N2O4P — CID 163586771
(1Z)-N-[ethenyl-[(2-nitrophenyl)methoxy]phosphoryl]buta-1,3-dien-1-amine (PubChem CID 163586771) has the molecular formula C13H15N2O4P and a molecular weight of 294.25 g/mol. Its IUPAC name is (1Z)-N-[ethenyl-[(2-nitrophenyl)methoxy]phosphoryl]buta-1,3-dien-1-amine.
| Compound Name | (1Z)-N-[ethenyl-[(2-nitrophenyl)methoxy]phosphoryl]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163586771 |
| Molecular Formula | C13H15N2O4P |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (1Z)-N-[ethenyl-[(2-nitrophenyl)methoxy]phosphoryl]buta-1,3-dien-1-amine |
| SMILES | C=C/C=C\NP(=O)(C=C)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N2O4P/c1-3-5-10-14-20(18,4-2)19-11-12-8-6-7-9-13(12)15(16)17/h3-10H,1-2,11H2,(H,14,18)/b10-5- |
| InChIKey | GMCZYNFEFJJKFU-YHYXMXQVSA-N |
| XLogP | 3.74 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|