About (2-nitrophenyl)methyl sulfite
(2-nitrophenyl)methyl sulfite (PubChem CID 89385987) has the molecular formula C7H6NO5S-
and a molecular weight of 216.19 g/mol. Its IUPAC name is (2-nitrophenyl)methyl sulfite.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl sulfite |
| PubChem CID | 89385987 |
| Molecular Formula | C7H6NO5S- |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | (2-nitrophenyl)methyl sulfite |
| SMILES | O=[N+]([O-])c1ccccc1COS(=O)[O-] |
| InChI | InChI=1S/C7H7NO5S/c9-8(10)7-4-2-1-3-6(7)5-13-14(11)12/h1-4H,5H2,(H,11,12)/p-1 |
| InChIKey | LPDWHLMRNJVGPF-UHFFFAOYSA-M |
| XLogP | 0.91 |
| TPSA | 92.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl sulfite?
The IUPAC name of (2-nitrophenyl)methyl sulfite (CID 89385987) is (2-nitrophenyl)methyl sulfite.
What is the SMILES notation for (2-nitrophenyl)methyl sulfite?
The canonical SMILES for (2-nitrophenyl)methyl sulfite is O=[N+]([O-])c1ccccc1COS(=O)[O-].
What is the InChIKey of (2-nitrophenyl)methyl sulfite?
The InChIKey is LPDWHLMRNJVGPF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7NO5S/c9-8(10)7-4-2-1-3-6(7)5-13-14(11)12/h1-4H,5H2,(H,11,12)/p-1.
What are the key properties of (2-nitrophenyl)methyl sulfite?
(2-nitrophenyl)methyl sulfite has a molecular weight of 216.19 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl sulfite is sourced from PubChem (CID 89385987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).