About (2-nitrophenyl)methyl thiohypofluorite
(2-nitrophenyl)methyl thiohypofluorite (PubChem CID 156702153) has the molecular formula C7H6FNO2S
and a molecular weight of 187.19 g/mol. Its IUPAC name is (2-nitrophenyl)methyl thiohypofluorite.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl thiohypofluorite |
| PubChem CID | 156702153 |
| Molecular Formula | C7H6FNO2S |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | (2-nitrophenyl)methyl thiohypofluorite |
| SMILES | O=[N+]([O-])c1ccccc1CSF |
| InChI | InChI=1S/C7H6FNO2S/c8-12-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2 |
| InChIKey | YUIKUBACHSYGMR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl thiohypofluorite?
The IUPAC name of (2-nitrophenyl)methyl thiohypofluorite (CID 156702153) is (2-nitrophenyl)methyl thiohypofluorite.
What is the SMILES notation for (2-nitrophenyl)methyl thiohypofluorite?
The canonical SMILES for (2-nitrophenyl)methyl thiohypofluorite is O=[N+]([O-])c1ccccc1CSF.
What is the InChIKey of (2-nitrophenyl)methyl thiohypofluorite?
The InChIKey is YUIKUBACHSYGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO2S/c8-12-5-6-3-1-2-4-7(6)9(10)11/h1-4H,5H2.
What are the key properties of (2-nitrophenyl)methyl thiohypofluorite?
(2-nitrophenyl)methyl thiohypofluorite has a molecular weight of 187.19 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl thiohypofluorite is sourced from PubChem (CID 156702153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).