About 2-(2-nitrophenyl)ethyl hydrogen phosphate
2-(2-nitrophenyl)ethyl hydrogen phosphate (PubChem CID 173144888) has the molecular formula C8H9NO6P-
and a molecular weight of 246.13 g/mol. Its IUPAC name is 2-(2-nitrophenyl)ethyl hydrogen phosphate.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)ethyl hydrogen phosphate |
| PubChem CID | 173144888 |
| Molecular Formula | C8H9NO6P- |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 2-(2-nitrophenyl)ethyl hydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccccc1CCOP(=O)([O-])O |
| InChI | InChI=1S/C8H10NO6P/c10-9(11)8-4-2-1-3-7(8)5-6-15-16(12,13)14/h1-4H,5-6H2,(H2,12,13,14)/p-1 |
| InChIKey | LUEVFLFUJHCFGU-UHFFFAOYSA-M |
| XLogP | 0.61 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)ethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)ethyl hydrogen phosphate?
The IUPAC name of 2-(2-nitrophenyl)ethyl hydrogen phosphate (CID 173144888) is 2-(2-nitrophenyl)ethyl hydrogen phosphate.
What is the SMILES notation for 2-(2-nitrophenyl)ethyl hydrogen phosphate?
The canonical SMILES for 2-(2-nitrophenyl)ethyl hydrogen phosphate is O=[N+]([O-])c1ccccc1CCOP(=O)([O-])O.
What is the InChIKey of 2-(2-nitrophenyl)ethyl hydrogen phosphate?
The InChIKey is LUEVFLFUJHCFGU-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10NO6P/c10-9(11)8-4-2-1-3-7(8)5-6-15-16(12,13)14/h1-4H,5-6H2,(H2,12,13,14)/p-1.
What are the key properties of 2-(2-nitrophenyl)ethyl hydrogen phosphate?
2-(2-nitrophenyl)ethyl hydrogen phosphate has a molecular weight of 246.13 g/mol, XLogP of 0.61, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)ethyl hydrogen phosphate is sourced from PubChem (CID 173144888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).