C10H12NO7P — CID 175249180
phosphono 4-(2-nitrophenyl)butanoate (PubChem CID 175249180) has the molecular formula C10H12NO7P and a molecular weight of 289.18 g/mol. Its IUPAC name is phosphono 4-(2-nitrophenyl)butanoate.
| Compound Name | phosphono 4-(2-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 175249180 |
| Molecular Formula | C10H12NO7P |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | phosphono 4-(2-nitrophenyl)butanoate |
| SMILES | O=C(CCCc1ccccc1[N+](=O)[O-])OP(=O)(O)O |
| InChI | InChI=1S/C10H12NO7P/c12-10(18-19(15,16)17)7-3-5-8-4-1-2-6-9(8)11(13)14/h1-2,4,6H,3,5,7H2,(H2,15,16,17) |
| InChIKey | DBVKAWUWCKEMTI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|