C22H30N2O7 — CID 67111402
(2R)-2-aminopentanedioic acid;3-(4-hydroxyphenyl)propanoic acid;2-phenylethanamine (PubChem CID 67111402) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is (2R)-2-aminopentanedioic acid;3-(4-hydroxyphenyl)propanoic acid;2-phenylethanamine.
| Compound Name | (2R)-2-aminopentanedioic acid;3-(4-hydroxyphenyl)propanoic acid;2-phenylethanamine |
|---|---|
| PubChem CID | 67111402 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2R)-2-aminopentanedioic acid;3-(4-hydroxyphenyl)propanoic acid;2-phenylethanamine |
| SMILES | NCCc1ccccc1.N[C@H](CCC(=O)O)C(=O)O.O=C(O)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O3.C8H11N.C5H9NO4/c10-8-4-1-7(2-5-8)3-6-9(11)12;9-7-6-8-4-2-1-3-5-8;6-3(5(9)10)1-2-4(7)8/h1-2,4-5,10H,3,6H2,(H,11,12);1-5H,6-7,9H2;3H,1-2,6H2,(H,7,8)(H,9,10)/t;;3-/m..1/s1 |
| InChIKey | QCYKEYIJUNFBEK-CFMHHUGTSA-N |
| XLogP | 1.86 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |