C13H16NNaO5 — CID 161124735
sodium;(2S)-2-aminopentanedioic acid;2-phenylethanone (PubChem CID 161124735) has the molecular formula C13H16NNaO5 and a molecular weight of 289.26 g/mol. Its IUPAC name is sodium;(2S)-2-aminopentanedioic acid;2-phenylethanone.
| Compound Name | sodium;(2S)-2-aminopentanedioic acid;2-phenylethanone |
|---|---|
| PubChem CID | 161124735 |
| Molecular Formula | C13H16NNaO5 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | sodium;(2S)-2-aminopentanedioic acid;2-phenylethanone |
| SMILES | N[C@@H](CCC(=O)O)C(=O)O.O=[C-]Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H7O.C5H9NO4.Na/c9-7-6-8-4-2-1-3-5-8;6-3(5(9)10)1-2-4(7)8;/h1-5H,6H2;3H,1-2,6H2,(H,7,8)(H,9,10);/q-1;;+1/t;3-;/m.0./s1 |
| InChIKey | ZSOYCYMDYYDCEK-RJXKWAGSSA-N |
| XLogP | -2.39 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|