C16H26NO5PS — CID 166771339
(4R)-4-(tert-butylsulfinylamino)-4-[hydroxy(2-phenylethyl)phosphoryl]butanoic acid (PubChem CID 166771339) has the molecular formula C16H26NO5PS and a molecular weight of 375.43 g/mol. Its IUPAC name is (4R)-4-(tert-butylsulfinylamino)-4-[hydroxy(2-phenylethyl)phosphoryl]butanoic acid.
| Compound Name | (4R)-4-(tert-butylsulfinylamino)-4-[hydroxy(2-phenylethyl)phosphoryl]butanoic acid |
|---|---|
| PubChem CID | 166771339 |
| Molecular Formula | C16H26NO5PS |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (4R)-4-(tert-butylsulfinylamino)-4-[hydroxy(2-phenylethyl)phosphoryl]butanoic acid |
| SMILES | CC(C)(C)S(=O)N[C@@H](CCC(=O)O)P(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C16H26NO5PS/c1-16(2,3)24(22)17-14(9-10-15(18)19)23(20,21)12-11-13-7-5-4-6-8-13/h4-8,14,17H,9-12H2,1-3H3,(H,18,19)(H,20,21)/t14-,24?/m1/s1 |
| InChIKey | OWSLMCXIXLAZBP-GMBBYQRISA-N |
| XLogP | 2.74 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|