C20H27NOS — CID 101420817
N-(1,4-diphenylbutan-2-yl)-2-methylpropane-2-sulfinamide (PubChem CID 101420817) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is N-(1,4-diphenylbutan-2-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | N-(1,4-diphenylbutan-2-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 101420817 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-(1,4-diphenylbutan-2-yl)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H27NOS/c1-20(2,3)23(22)21-19(16-18-12-8-5-9-13-18)15-14-17-10-6-4-7-11-17/h4-13,19,21H,14-16H2,1-3H3 |
| InChIKey | RPSMIANJBYBNGT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |