About (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide
(S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 46946716) has the molecular formula C18H29NOS
and a molecular weight of 307.50 g/mol. Its IUPAC name is (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 46946716 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(C)(C)[C@H](CCc1ccccc1)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C18H29NOS/c1-7-18(5,6)16(19-21(20)17(2,3)4)14-13-15-11-9-8-10-12-15/h7-12,16,19H,1,13-14H2,2-6H3/t16-,21-/m0/s1 |
| InChIKey | PLUUZXOFKZXEDD-KKSFZXQISA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide (CID 46946716) is (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide is C=CC(C)(C)[C@H](CCc1ccccc1)N[S@@](=O)C(C)(C)C.
What is the InChIKey of (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide?
The InChIKey is PLUUZXOFKZXEDD-KKSFZXQISA-N. The full InChI is InChI=1S/C18H29NOS/c1-7-18(5,6)16(19-21(20)17(2,3)4)14-13-15-11-9-8-10-12-15/h7-12,16,19H,1,13-14H2,2-6H3/t16-,21-/m0/s1.
What are the key properties of (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide?
(S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide has a molecular weight of 307.50 g/mol, XLogP of 4.25, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 46946716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).