C18H29NOS — CID 46946716
(S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 46946716) has the molecular formula C18H29NOS and a molecular weight of 307.50 g/mol. Its IUPAC name is (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 46946716 |
| Molecular Formula | C18H29NOS |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | (S)-N-[(3S)-4,4-dimethyl-1-phenylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(C)(C)[C@H](CCc1ccccc1)N[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C18H29NOS/c1-7-18(5,6)16(19-21(20)17(2,3)4)14-13-15-11-9-8-10-12-15/h7-12,16,19H,1,13-14H2,2-6H3/t16-,21-/m0/s1 |
| InChIKey | PLUUZXOFKZXEDD-KKSFZXQISA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|