About methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate
methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate (PubChem CID 11291095) has the molecular formula C23H29NO2
and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate |
| PubChem CID | 11291095 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate |
| SMILES | C=CC(C)(C)[C@@H](CCc1ccccc1)N[C@H](C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-5-23(2,3)20(17-16-18-12-8-6-9-13-18)24-21(22(25)26-4)19-14-10-7-11-15-19/h5-15,20-21,24H,1,16-17H2,2-4H3/t20-,21+/m1/s1 |
| InChIKey | PYWJTUQGCDZOKQ-RTWAWAEBSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate?
The IUPAC name of methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate (CID 11291095) is methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate.
What is the SMILES notation for methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate?
The canonical SMILES for methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate is C=CC(C)(C)[C@@H](CCc1ccccc1)N[C@H](C(=O)OC)c1ccccc1.
What is the InChIKey of methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate?
The InChIKey is PYWJTUQGCDZOKQ-RTWAWAEBSA-N. The full InChI is InChI=1S/C23H29NO2/c1-5-23(2,3)20(17-16-18-12-8-6-9-13-18)24-21(22(25)26-4)19-14-10-7-11-15-19/h5-15,20-21,24H,1,16-17H2,2-4H3/t20-,21+/m1/s1.
What are the key properties of methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate?
methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate has a molecular weight of 351.49 g/mol, XLogP of 4.70, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-[[(3R)-4,4-dimethyl-1-phenylhex-5-en-3-yl]amino]-2-phenylacetate is sourced from PubChem (CID 11291095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).