C21H26N2O — CID 101142591
N'-(4,4-dimethyl-1-phenylhex-5-en-3-yl)benzohydrazide (PubChem CID 101142591) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is N'-(4,4-dimethyl-1-phenylhex-5-en-3-yl)benzohydrazide.
| Compound Name | N'-(4,4-dimethyl-1-phenylhex-5-en-3-yl)benzohydrazide |
|---|---|
| PubChem CID | 101142591 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | N'-(4,4-dimethyl-1-phenylhex-5-en-3-yl)benzohydrazide |
| SMILES | C=CC(C)(C)C(CCc1ccccc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-4-21(2,3)19(16-15-17-11-7-5-8-12-17)22-23-20(24)18-13-9-6-10-14-18/h4-14,19,22H,1,15-16H2,2-3H3,(H,23,24) |
| InChIKey | ZUGJLGWIHCVJAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|