About 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide
2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide (PubChem CID 167271474) has the molecular formula C17H24N2O2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide |
| PubChem CID | 167271474 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CCCc1ccccc1)c1ncco1 |
| InChI | InChI=1S/C17H24N2O2S/c1-17(2,3)22(20)19-15(16-18-12-13-21-16)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,12-13,15,19H,7,10-11H2,1-3H3 |
| InChIKey | SPEQINYBRKCISQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide?
The IUPAC name of 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide (CID 167271474) is 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide.
What is the SMILES notation for 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide?
The canonical SMILES for 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide is CC(C)(C)S(=O)NC(CCCc1ccccc1)c1ncco1.
What is the InChIKey of 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide?
The InChIKey is SPEQINYBRKCISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2S/c1-17(2,3)22(20)19-15(16-18-12-13-21-16)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,12-13,15,19H,7,10-11H2,1-3H3.
What are the key properties of 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide?
2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide has a molecular weight of 320.46 g/mol, XLogP of 3.79, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[1-(1,3-oxazol-2-yl)-4-phenylbutyl]propane-2-sulfinamide is sourced from PubChem (CID 167271474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).