C17H27NOS — CID 134968659
(R)-2-methyl-N-[(3R,4S)-2-methyl-4-phenylhex-5-en-3-yl]propane-2-sulfinamide (PubChem CID 134968659) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is (R)-2-methyl-N-[(3R,4S)-2-methyl-4-phenylhex-5-en-3-yl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(3R,4S)-2-methyl-4-phenylhex-5-en-3-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 134968659 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (R)-2-methyl-N-[(3R,4S)-2-methyl-4-phenylhex-5-en-3-yl]propane-2-sulfinamide |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](N[S@](=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H27NOS/c1-7-15(14-11-9-8-10-12-14)16(13(2)3)18-20(19)17(4,5)6/h7-13,15-16,18H,1H2,2-6H3/t15-,16+,20+/m0/s1 |
| InChIKey | TYFOSBIFANVZNB-RZQQEMMASA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|