C21H27NO2S — CID 134941098
(S)-N-[(1S,2S)-1-(4-methoxyphenyl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 134941098) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is (S)-N-[(1S,2S)-1-(4-methoxyphenyl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(1S,2S)-1-(4-methoxyphenyl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134941098 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (S)-N-[(1S,2S)-1-(4-methoxyphenyl)-2-phenylbut-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@@H](c1ccccc1)[C@H](N[S@@](=O)C(C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H27NO2S/c1-6-19(16-10-8-7-9-11-16)20(22-25(23)21(2,3)4)17-12-14-18(24-5)15-13-17/h6-15,19-20,22H,1H2,2-5H3/t19-,20+,25-/m0/s1 |
| InChIKey | MWBZYJXYORCWLI-DFIYOIEZSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|