C20H23Br2NOS — CID 53241861
N-[(1R,2R)-1,2-bis(4-bromophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide (PubChem CID 53241861) has the molecular formula C20H23Br2NOS and a molecular weight of 485.29 g/mol. Its IUPAC name is N-[(1R,2R)-1,2-bis(4-bromophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R,2R)-1,2-bis(4-bromophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 53241861 |
| Molecular Formula | C20H23Br2NOS |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-[(1R,2R)-1,2-bis(4-bromophenyl)but-3-enyl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@H](c1ccc(Br)cc1)[C@@H](NS(=O)C(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23Br2NOS/c1-5-18(14-6-10-16(21)11-7-14)19(23-25(24)20(2,3)4)15-8-12-17(22)13-9-15/h5-13,18-19,23H,1H2,2-4H3/t18-,19+,25?/m1/s1 |
| InChIKey | OLKNTLKGMMGDHQ-VSVPBVKKSA-N |
| XLogP | 6.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|