C14H20FNOS — CID 67270473
(R)-N-[(1R)-1-fluoro-1-phenylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 67270473) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is (R)-N-[(1R)-1-fluoro-1-phenylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-fluoro-1-phenylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 67270473 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (R)-N-[(1R)-1-fluoro-1-phenylbut-3-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC(N[S@](=O)C(C)(C)C)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C14H20FNOS/c1-5-12(16-18(17)14(2,3)4)13(15)11-9-7-6-8-10-11/h5-10,12-13,16H,1H2,2-4H3/t12?,13-,18-/m1/s1 |
| InChIKey | CZLSUCAFYOTZCW-CQWUKTPGSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|