C13H17NOS — CID 122211944
2-methyl-N-[(1R)-1-phenylprop-2-ynyl]propane-2-sulfinamide (PubChem CID 122211944) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-phenylprop-2-ynyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(1R)-1-phenylprop-2-ynyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 122211944 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-methyl-N-[(1R)-1-phenylprop-2-ynyl]propane-2-sulfinamide |
| SMILES | C#C[C@@H](NS(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H17NOS/c1-5-12(11-9-7-6-8-10-11)14-16(15)13(2,3)4/h1,6-10,12,14H,2-4H3/t12-,16?/m1/s1 |
| InChIKey | QOJAVAIJMOCNQD-ZGTOLYCTSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|