C15H18F3NOS — CID 165386588
(S)-2-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]propane-2-sulfinamide (PubChem CID 165386588) has the molecular formula C15H18F3NOS and a molecular weight of 317.38 g/mol. Its IUPAC name is (S)-2-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 165386588 |
| Molecular Formula | C15H18F3NOS |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (S)-2-methyl-N-[(1R)-1-[2-methyl-3-(trifluoromethyl)phenyl]prop-2-ynyl]propane-2-sulfinamide |
| SMILES | C#C[C@@H](N[S@@](=O)C(C)(C)C)c1cccc(C(F)(F)F)c1C |
| InChI | InChI=1S/C15H18F3NOS/c1-6-13(19-21(20)14(3,4)5)11-8-7-9-12(10(11)2)15(16,17)18/h1,7-9,13,19H,2-5H3/t13-,21+/m1/s1 |
| InChIKey | WOKDBVFQYJDASD-ASSNKEHSSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|