C17H27NOSSi — CID 102173687
2-methyl-N-(1-phenyl-4-trimethylsilylbut-3-ynyl)propane-2-sulfinamide (PubChem CID 102173687) has the molecular formula C17H27NOSSi and a molecular weight of 321.56 g/mol. Its IUPAC name is 2-methyl-N-(1-phenyl-4-trimethylsilylbut-3-ynyl)propane-2-sulfinamide.
| Compound Name | 2-methyl-N-(1-phenyl-4-trimethylsilylbut-3-ynyl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 102173687 |
| Molecular Formula | C17H27NOSSi |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-methyl-N-(1-phenyl-4-trimethylsilylbut-3-ynyl)propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CC#C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H27NOSSi/c1-17(2,3)20(19)18-16(13-10-14-21(4,5)6)15-11-8-7-9-12-15/h7-9,11-12,16,18H,13H2,1-6H3 |
| InChIKey | GBRPMSKJPIVKGN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|