C30H32NO2PS — CID 166597619
(S)-N-[(R)-(2-diphenylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 166597619) has the molecular formula C30H32NO2PS and a molecular weight of 501.63 g/mol. Its IUPAC name is (S)-N-[(R)-(2-diphenylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(R)-(2-diphenylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 166597619 |
| Molecular Formula | C30H32NO2PS |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (S)-N-[(R)-(2-diphenylphosphanylphenyl)-(4-methoxyphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1ccc([C@@H](N[S@@](=O)C(C)(C)C)c2ccccc2P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32NO2PS/c1-30(2,3)35(32)31-29(23-19-21-24(33-4)22-20-23)27-17-11-12-18-28(27)34(25-13-7-5-8-14-25)26-15-9-6-10-16-26/h5-22,29,31H,1-4H3/t29-,35+/m1/s1 |
| InChIKey | JSJZIHJKTOOMLL-UYHPJTEGSA-N |
| XLogP | 5.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|