C36H37NOP2S — CID 154728529
N-[(1R)-2-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 154728529) has the molecular formula C36H37NOP2S and a molecular weight of 593.71 g/mol. Its IUPAC name is N-[(1R)-2-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(1R)-2-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 154728529 |
| Molecular Formula | C36H37NOP2S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | N-[(1R)-2-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)N[C@@H](CP(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H37NOP2S/c1-36(2,3)41(38)37-34(28-39(29-18-8-4-9-19-29)30-20-10-5-11-21-30)33-26-16-17-27-35(33)40(31-22-12-6-13-23-31)32-24-14-7-15-25-32/h4-27,34,37H,28H2,1-3H3/t34-,41?/m0/s1 |
| InChIKey | ICLDONXQGZEXEU-YUBUVMJQSA-N |
| XLogP | 6.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|