C35H36NO3PS — CID 155885270
N-[(S)-(2-diphenylphosphanyl-4,5-dimethoxyphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide (PubChem CID 155885270) has the molecular formula C35H36NO3PS and a molecular weight of 581.72 g/mol. Its IUPAC name is N-[(S)-(2-diphenylphosphanyl-4,5-dimethoxyphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(S)-(2-diphenylphosphanyl-4,5-dimethoxyphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 155885270 |
| Molecular Formula | C35H36NO3PS |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | N-[(S)-(2-diphenylphosphanyl-4,5-dimethoxyphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide |
| SMILES | COc1cc([C@@H](NS(=O)C(C)(C)C)c2cccc3ccccc23)c(P(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C35H36NO3PS/c1-35(2,3)41(37)36-34(29-22-14-16-25-15-12-13-21-28(25)29)30-23-31(38-4)32(39-5)24-33(30)40(26-17-8-6-9-18-26)27-19-10-7-11-20-27/h6-24,34,36H,1-5H3/t34-,41?/m0/s1 |
| InChIKey | GDVFMOUEWXCVPL-YUBUVMJQSA-N |
| XLogP | 6.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|