C29H40NOPS — CID 164887402
(R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide (PubChem CID 164887402) has the molecular formula C29H40NOPS and a molecular weight of 481.69 g/mol. Its IUPAC name is (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 164887402 |
| Molecular Formula | C29H40NOPS |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (R)-N-[(S)-(2-ditert-butylphosphanylphenyl)-naphthalen-1-ylmethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)P(c1ccccc1[C@@H](N[S@](=O)C(C)(C)C)c1cccc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C29H40NOPS/c1-27(2,3)32(28(4,5)6)25-20-13-12-18-24(25)26(30-33(31)29(7,8)9)23-19-14-16-21-15-10-11-17-22(21)23/h10-20,26,30H,1-9H3/t26-,33+/m0/s1 |
| InChIKey | YUSQSKNVFUIHQG-OOOSNSGVSA-N |
| XLogP | 7.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|