C29H48NOPS — CID 162420735
(R)-N-[(S)-1-adamantyl-(2-ditert-butylphosphanylphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 162420735) has the molecular formula C29H48NOPS and a molecular weight of 489.75 g/mol. Its IUPAC name is (R)-N-[(S)-1-adamantyl-(2-ditert-butylphosphanylphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-1-adamantyl-(2-ditert-butylphosphanylphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162420735 |
| Molecular Formula | C29H48NOPS |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | (R)-N-[(S)-1-adamantyl-(2-ditert-butylphosphanylphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)P(c1ccccc1[C@@H](N[S@](=O)C(C)(C)C)C12CC3CC(CC(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C29H48NOPS/c1-26(2,3)32(27(4,5)6)24-13-11-10-12-23(24)25(30-33(31)28(7,8)9)29-17-20-14-21(18-29)16-22(15-20)19-29/h10-13,20-22,25,30H,14-19H2,1-9H3/t20?,21?,22?,25-,29?,33-/m1/s1 |
| InChIKey | ANDAEMPIIGEHED-DCHPEXOPSA-N |
| XLogP | 7.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|