C26H40NOPS — CID 162393879
N-[(S)-(2-ditert-butylphosphanylphenyl)-(2-methylphenyl)methyl]-2-methylpropane-2-sulfinamide (PubChem CID 162393879) has the molecular formula C26H40NOPS and a molecular weight of 445.65 g/mol. Its IUPAC name is N-[(S)-(2-ditert-butylphosphanylphenyl)-(2-methylphenyl)methyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(S)-(2-ditert-butylphosphanylphenyl)-(2-methylphenyl)methyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 162393879 |
| Molecular Formula | C26H40NOPS |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[(S)-(2-ditert-butylphosphanylphenyl)-(2-methylphenyl)methyl]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1ccccc1[C@H](NS(=O)C(C)(C)C)c1ccccc1P(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H40NOPS/c1-19-15-11-12-16-20(19)23(27-30(28)26(8,9)10)21-17-13-14-18-22(21)29(24(2,3)4)25(5,6)7/h11-18,23,27H,1-10H3/t23-,30?/m0/s1 |
| InChIKey | DDRKSUSIFOAIHS-IHOKFDBFSA-N |
| XLogP | 6.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|