C16H21NO2S — CID 102392141
2-methyl-N-[(S)-(3-methylfuran-2-yl)-phenylmethyl]propane-2-sulfinamide (PubChem CID 102392141) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-methyl-N-[(S)-(3-methylfuran-2-yl)-phenylmethyl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(S)-(3-methylfuran-2-yl)-phenylmethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 102392141 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-methyl-N-[(S)-(3-methylfuran-2-yl)-phenylmethyl]propane-2-sulfinamide |
| SMILES | Cc1ccoc1[C@@H](NS(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H21NO2S/c1-12-10-11-19-15(12)14(13-8-6-5-7-9-13)17-20(18)16(2,3)4/h5-11,14,17H,1-4H3/t14-,20?/m0/s1 |
| InChIKey | REYIELSQFHCPEL-PVCZSOGJSA-N |
| XLogP | 3.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |