C17H21FN2OS — CID 118355988
(R)-N-[(S)-(3-amino-4-fluorophenyl)-phenylmethyl]-2-methylpropane-2-sulfinamide (PubChem CID 118355988) has the molecular formula C17H21FN2OS and a molecular weight of 320.43 g/mol. Its IUPAC name is (R)-N-[(S)-(3-amino-4-fluorophenyl)-phenylmethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(S)-(3-amino-4-fluorophenyl)-phenylmethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118355988 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (R)-N-[(S)-(3-amino-4-fluorophenyl)-phenylmethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)N[C@@H](c1ccccc1)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C17H21FN2OS/c1-17(2,3)22(21)20-16(12-7-5-4-6-8-12)13-9-10-14(18)15(19)11-13/h4-11,16,20H,19H2,1-3H3/t16-,22+/m0/s1 |
| InChIKey | AFEAHLLQKPXFRI-KSFYIVLOSA-N |
| XLogP | 3.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|