C17H19FN2 — CID 118355580
5-[(cyclopropylmethylamino)-phenylmethyl]-2-fluoroaniline (PubChem CID 118355580) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 5-[(cyclopropylmethylamino)-phenylmethyl]-2-fluoroaniline.
| Compound Name | 5-[(cyclopropylmethylamino)-phenylmethyl]-2-fluoroaniline |
|---|---|
| PubChem CID | 118355580 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-[(cyclopropylmethylamino)-phenylmethyl]-2-fluoroaniline |
| SMILES | Nc1cc(C(NCC2CC2)c2ccccc2)ccc1F |
| InChI | InChI=1S/C17H19FN2/c18-15-9-8-14(10-16(15)19)17(20-11-12-6-7-12)13-4-2-1-3-5-13/h1-5,8-10,12,17,20H,6-7,11,19H2 |
| InChIKey | FPRYBVCEABGRKM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|