C19H18FN3O — CID 144916408
N-[5-[(4-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide (PubChem CID 144916408) has the molecular formula C19H18FN3O and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[5-[(4-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide.
| Compound Name | N-[5-[(4-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide |
|---|---|
| PubChem CID | 144916408 |
| Molecular Formula | C19H18FN3O |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[5-[(4-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide |
| SMILES | N#Cc1ccc(C(NCC2CC2)c2ccc(F)c(NC=O)c2)cc1 |
| InChI | InChI=1S/C19H18FN3O/c20-17-8-7-16(9-18(17)23-12-24)19(22-11-14-1-2-14)15-5-3-13(10-21)4-6-15/h3-9,12,14,19,22H,1-2,11H2,(H,23,24) |
| InChIKey | DTGQGPGBRQPZDZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|