C25H33FN4O — CID 145286606
N-[5-[(3-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide;ethane;pyrrolidine (PubChem CID 145286606) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is N-[5-[(3-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide;ethane;pyrrolidine.
| Compound Name | N-[5-[(3-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide;ethane;pyrrolidine |
|---|---|
| PubChem CID | 145286606 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-[5-[(3-cyanophenyl)-(cyclopropylmethylamino)methyl]-2-fluorophenyl]formamide;ethane;pyrrolidine |
| SMILES | C1CCNC1.CC.N#Cc1cccc(C(NCC2CC2)c2ccc(F)c(NC=O)c2)c1 |
| InChI | InChI=1S/C19H18FN3O.C4H9N.C2H6/c20-17-7-6-16(9-18(17)23-12-24)19(22-11-13-4-5-13)15-3-1-2-14(8-15)10-21;1-2-4-5-3-1;1-2/h1-3,6-9,12-13,19,22H,4-5,11H2,(H,23,24);5H,1-4H2;1-2H3 |
| InChIKey | QOJVZFIKBZRXPN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|