C34H37F4N3O2 — CID 144917257
N-(cyclopropylmethyl)-1-(4-fluoro-3-methylphenyl)-1-(3-methoxyphenyl)methanamine;ethane;3-[[(2Z)-1-oxo-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzonitrile (PubChem CID 144917257) has the molecular formula C34H37F4N3O2 and a molecular weight of 595.68 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-1-(4-fluoro-3-methylphenyl)-1-(3-methoxyphenyl)methanamine;ethane;3-[[(2Z)-1-oxo-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzonitrile.
| Compound Name | N-(cyclopropylmethyl)-1-(4-fluoro-3-methylphenyl)-1-(3-methoxyphenyl)methanamine;ethane;3-[[(2Z)-1-oxo-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 144917257 |
| Molecular Formula | C34H37F4N3O2 |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | N-(cyclopropylmethyl)-1-(4-fluoro-3-methylphenyl)-1-(3-methoxyphenyl)methanamine;ethane;3-[[(2Z)-1-oxo-4-(trifluoromethyl)penta-2,4-dien-2-yl]amino]benzonitrile |
| SMILES | C=C(/C=C(/C=O)Nc1cccc(C#N)c1)C(F)(F)F.CC.COc1cccc(C(NCC2CC2)c2ccc(F)c(C)c2)c1 |
| InChI | InChI=1S/C19H22FNO.C13H9F3N2O.C2H6/c1-13-10-16(8-9-18(13)20)19(21-12-14-6-7-14)15-4-3-5-17(11-15)22-2;1-9(13(14,15)16)5-12(8-19)18-11-4-2-3-10(6-11)7-17;1-2/h3-5,8-11,14,19,21H,6-7,12H2,1-2H3;2-6,8,18H,1H2;1-2H3/b;12-5-; |
| InChIKey | SYOOQDWTXKDILP-XWILHGFGSA-N |
| XLogP | 8.43 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|