C31H33F3N4O2 — CID 144916638
(2Z)-2-[3-(aminomethyl)anilino]-N-[3-[(cyclopropylmethylamino)-(4-methoxyphenyl)methyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 144916638) has the molecular formula C31H33F3N4O2 and a molecular weight of 550.63 g/mol. Its IUPAC name is (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[(cyclopropylmethylamino)-(4-methoxyphenyl)methyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[(cyclopropylmethylamino)-(4-methoxyphenyl)methyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144916638 |
| Molecular Formula | C31H33F3N4O2 |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[(cyclopropylmethylamino)-(4-methoxyphenyl)methyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | C=C(/C=C(\Nc1cccc(CN)c1)C(=O)Nc1cccc(C(NCC2CC2)c2ccc(OC)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C31H33F3N4O2/c1-20(31(32,33)34)15-28(37-25-7-3-5-22(16-25)18-35)30(39)38-26-8-4-6-24(17-26)29(36-19-21-9-10-21)23-11-13-27(40-2)14-12-23/h3-8,11-17,21,29,36-37H,1,9-10,18-19,35H2,2H3,(H,38,39)/b28-15- |
| InChIKey | UCWZOUXYZJKBMN-MBTHVWNTSA-N |
| XLogP | 6.30 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|