C33H38F3N3O2 — CID 144916655
(2Z)-2-[3-(aminomethyl)-N-methylanilino]-N-[3-[1-(3-hydroxyphenyl)ethyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide;ethylcyclopropane (PubChem CID 144916655) has the molecular formula C33H38F3N3O2 and a molecular weight of 565.68 g/mol. Its IUPAC name is (2Z)-2-[3-(aminomethyl)-N-methylanilino]-N-[3-[1-(3-hydroxyphenyl)ethyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide;ethylcyclopropane.
| Compound Name | (2Z)-2-[3-(aminomethyl)-N-methylanilino]-N-[3-[1-(3-hydroxyphenyl)ethyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide;ethylcyclopropane |
|---|---|
| PubChem CID | 144916655 |
| Molecular Formula | C33H38F3N3O2 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | (2Z)-2-[3-(aminomethyl)-N-methylanilino]-N-[3-[1-(3-hydroxyphenyl)ethyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide;ethylcyclopropane |
| SMILES | C=C(/C=C(/C(=O)Nc1cccc(C(C)c2cccc(O)c2)c1)N(C)c1cccc(CN)c1)C(F)(F)F.CCC1CC1 |
| InChI | InChI=1S/C28H28F3N3O2.C5H10/c1-18(28(29,30)31)13-26(34(3)24-11-4-7-20(14-24)17-32)27(36)33-23-10-5-8-21(15-23)19(2)22-9-6-12-25(35)16-22;1-2-5-3-4-5/h4-16,19,35H,1,17,32H2,2-3H3,(H,33,36);5H,2-4H2,1H3/b26-13-; |
| InChIKey | SZVSRQKQFHHXDS-BQHDHOAWSA-N |
| XLogP | 7.89 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|