C29H30F3N3O2 — CID 144916347
(2Z)-2-[3-(aminomethyl)anilino]-N-[3-[1-(4-hydroxyphenyl)butyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 144916347) has the molecular formula C29H30F3N3O2 and a molecular weight of 509.57 g/mol. Its IUPAC name is (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[1-(4-hydroxyphenyl)butyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[1-(4-hydroxyphenyl)butyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144916347 |
| Molecular Formula | C29H30F3N3O2 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-[1-(4-hydroxyphenyl)butyl]phenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | C=C(/C=C(\Nc1cccc(CN)c1)C(=O)Nc1cccc(C(CCC)c2ccc(O)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C29H30F3N3O2/c1-3-6-26(21-11-13-25(36)14-12-21)22-8-5-10-24(17-22)35-28(37)27(15-19(2)29(30,31)32)34-23-9-4-7-20(16-23)18-33/h4-5,7-17,26,34,36H,2-3,6,18,33H2,1H3,(H,35,37)/b27-15- |
| InChIKey | GOWXHRACQFYXEI-DICXZTSXSA-N |
| XLogP | 6.84 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|