C18H21F3N2O — CID 144917146
(2Z,4Z)-N-ethenyl-2-(3-ethylanilino)-4-(trifluoromethyl)hepta-2,4-dienamide (PubChem CID 144917146) has the molecular formula C18H21F3N2O and a molecular weight of 338.37 g/mol. Its IUPAC name is (2Z,4Z)-N-ethenyl-2-(3-ethylanilino)-4-(trifluoromethyl)hepta-2,4-dienamide.
| Compound Name | (2Z,4Z)-N-ethenyl-2-(3-ethylanilino)-4-(trifluoromethyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 144917146 |
| Molecular Formula | C18H21F3N2O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2Z,4Z)-N-ethenyl-2-(3-ethylanilino)-4-(trifluoromethyl)hepta-2,4-dienamide |
| SMILES | C=CNC(=O)/C(=C/C(=C/CC)C(F)(F)F)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C18H21F3N2O/c1-4-8-14(18(19,20)21)12-16(17(24)22-6-3)23-15-10-7-9-13(5-2)11-15/h6-12,23H,3-5H2,1-2H3,(H,22,24)/b14-8-,16-12- |
| InChIKey | CTELDORKDFLJEY-GWIMSDAFSA-N |
| XLogP | 4.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|