C36H44F4N4O — CID 144916387
(5Z,7Z)-5-[3-(aminomethyl)anilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-amine (PubChem CID 144916387) has the molecular formula C36H44F4N4O and a molecular weight of 624.77 g/mol. Its IUPAC name is (5Z,7Z)-5-[3-(aminomethyl)anilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-amine.
| Compound Name | (5Z,7Z)-5-[3-(aminomethyl)anilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-amine |
|---|---|
| PubChem CID | 144916387 |
| Molecular Formula | C36H44F4N4O |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | (5Z,7Z)-5-[3-(aminomethyl)anilino]-7-(trifluoromethyl)deca-5,7-dien-4-one;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-amine |
| SMILES | CC/C=C(/C=C(\Nc1cccc(CN)c1)C(=O)CCC)C(F)(F)F.Cc1cc(C(N)(CCC2CC2)c2cccnc2)ccc1F |
| InChI | InChI=1S/C18H23F3N2O.C18H21FN2/c1-3-6-14(18(19,20)21)11-16(17(24)7-4-2)23-15-9-5-8-13(10-15)12-22;1-13-11-15(6-7-17(13)19)18(20,9-8-14-4-5-14)16-3-2-10-21-12-16/h5-6,8-11,23H,3-4,7,12,22H2,1-2H3;2-3,6-7,10-12,14H,4-5,8-9,20H2,1H3/b14-6-,16-11-; |
| InChIKey | XIBQPQSFVVWNJY-BVFPLYDLSA-N |
| XLogP | 8.63 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|