C36H43F4N3O2 — CID 144916933
(2Z,4Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)hepta-2,4-dienal;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-ol;prop-1-ene (PubChem CID 144916933) has the molecular formula C36H43F4N3O2 and a molecular weight of 625.75 g/mol. Its IUPAC name is (2Z,4Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)hepta-2,4-dienal;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-ol;prop-1-ene.
| Compound Name | (2Z,4Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)hepta-2,4-dienal;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 144916933 |
| Molecular Formula | C36H43F4N3O2 |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.33 |
| IUPAC Name | (2Z,4Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)hepta-2,4-dienal;3-cyclopropyl-1-(4-fluoro-3-methylphenyl)-1-pyridin-3-ylpropan-1-ol;prop-1-ene |
| SMILES | C=CC.CC/C=C(/C=C(/C=O)Nc1cccc(CN)c1)C(F)(F)F.Cc1cc(C(O)(CCC2CC2)c2cccnc2)ccc1F |
| InChI | InChI=1S/C18H20FNO.C15H17F3N2O.C3H6/c1-13-11-15(6-7-17(13)19)18(21,9-8-14-4-5-14)16-3-2-10-20-12-16;1-2-4-12(15(16,17)18)8-14(10-21)20-13-6-3-5-11(7-13)9-19;1-3-2/h2-3,6-7,10-12,14,21H,4-5,8-9H2,1H3;3-8,10,20H,2,9,19H2,1H3;3H,1H2,2H3/b;12-4-,14-8-; |
| InChIKey | MDWUJHWLMAFPEB-SHFKAGGASA-N |
| XLogP | 8.69 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|