C34H42F3N3O — CID 144916735
(2Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)penta-2,4-dienal;3-(3-cyclopropyl-1-phenylpropyl)-N-methylaniline;ethane (PubChem CID 144916735) has the molecular formula C34H42F3N3O and a molecular weight of 565.72 g/mol. Its IUPAC name is (2Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)penta-2,4-dienal;3-(3-cyclopropyl-1-phenylpropyl)-N-methylaniline;ethane.
| Compound Name | (2Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)penta-2,4-dienal;3-(3-cyclopropyl-1-phenylpropyl)-N-methylaniline;ethane |
|---|---|
| PubChem CID | 144916735 |
| Molecular Formula | C34H42F3N3O |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | (2Z)-2-[3-(aminomethyl)anilino]-4-(trifluoromethyl)penta-2,4-dienal;3-(3-cyclopropyl-1-phenylpropyl)-N-methylaniline;ethane |
| SMILES | C=C(/C=C(/C=O)Nc1cccc(CN)c1)C(F)(F)F.CC.CNc1cccc(C(CCC2CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H23N.C13H13F3N2O.C2H6/c1-20-18-9-5-8-17(14-18)19(13-12-15-10-11-15)16-6-3-2-4-7-16;1-9(13(14,15)16)5-12(8-19)18-11-4-2-3-10(6-11)7-17;1-2/h2-9,14-15,19-20H,10-13H2,1H3;2-6,8,18H,1,7,17H2;1-2H3/b;12-5-; |
| InChIKey | XDEVPPQZDXOORM-XWILHGFGSA-N |
| XLogP | 8.84 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|