C31H31F4N3O — CID 144916206
(2Z)-2-[3-(aminomethyl)anilino]-N-[3-(3-cyclopropyl-1-phenylpropyl)-2-fluorophenyl]-4-(trifluoromethyl)penta-2,4-dienamide (PubChem CID 144916206) has the molecular formula C31H31F4N3O and a molecular weight of 537.60 g/mol. Its IUPAC name is (2Z)-2-[3-(aminomethyl)anilino]-N-[3-(3-cyclopropyl-1-phenylpropyl)-2-fluorophenyl]-4-(trifluoromethyl)penta-2,4-dienamide.
| Compound Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-(3-cyclopropyl-1-phenylpropyl)-2-fluorophenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144916206 |
| Molecular Formula | C31H31F4N3O |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | (2Z)-2-[3-(aminomethyl)anilino]-N-[3-(3-cyclopropyl-1-phenylpropyl)-2-fluorophenyl]-4-(trifluoromethyl)penta-2,4-dienamide |
| SMILES | C=C(/C=C(\Nc1cccc(CN)c1)C(=O)Nc1cccc(C(CCC2CC2)c2ccccc2)c1F)C(F)(F)F |
| InChI | InChI=1S/C31H31F4N3O/c1-20(31(33,34)35)17-28(37-24-10-5-7-22(18-24)19-36)30(39)38-27-12-6-11-26(29(27)32)25(16-15-21-13-14-21)23-8-3-2-4-9-23/h2-12,17-18,21,25,37H,1,13-16,19,36H2,(H,38,39)/b28-17- |
| InChIKey | RSXKVWJLJQYZKC-QRQIAZFYSA-N |
| XLogP | 7.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|