C30H35ClF4N4O2 — CID 144917047
(2Z)-N-[5-(1-chloro-3-cyclopropylpropyl)-2-fluorophenyl]-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienamide;ethane;2-methyliminoethanol (PubChem CID 144917047) has the molecular formula C30H35ClF4N4O2 and a molecular weight of 595.08 g/mol. Its IUPAC name is (2Z)-N-[5-(1-chloro-3-cyclopropylpropyl)-2-fluorophenyl]-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienamide;ethane;2-methyliminoethanol.
| Compound Name | (2Z)-N-[5-(1-chloro-3-cyclopropylpropyl)-2-fluorophenyl]-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienamide;ethane;2-methyliminoethanol |
|---|---|
| PubChem CID | 144917047 |
| Molecular Formula | C30H35ClF4N4O2 |
| Molecular Weight | 595.08 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (2Z)-N-[5-(1-chloro-3-cyclopropylpropyl)-2-fluorophenyl]-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienamide;ethane;2-methyliminoethanol |
| SMILES | C/N=C/CO.C=C(/C=C(\Nc1cccc(C#N)c1)C(=O)Nc1cc(C(Cl)CCC2CC2)ccc1F)C(F)(F)F.CC |
| InChI | InChI=1S/C25H22ClF4N3O.C3H7NO.C2H6/c1-15(25(28,29)30)11-23(32-19-4-2-3-17(12-19)14-31)24(34)33-22-13-18(8-10-21(22)27)20(26)9-7-16-5-6-16;1-4-2-3-5;1-2/h2-4,8,10-13,16,20,32H,1,5-7,9H2,(H,33,34);2,5H,3H2,1H3;1-2H3/b23-11-;4-2+; |
| InChIKey | HJSGOYJDHANPLY-OPIKQDHXSA-N |
| XLogP | 7.93 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.08 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|