C27H26F3N3O2S — CID 144916856
(2Z,4Z)-2-(3-cyanoanilino)-N-[3-[1-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enyl]phenyl]-4-(trifluoromethyl)hexa-2,4-dienamide (PubChem CID 144916856) has the molecular formula C27H26F3N3O2S and a molecular weight of 513.59 g/mol. Its IUPAC name is (2Z,4Z)-2-(3-cyanoanilino)-N-[3-[1-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enyl]phenyl]-4-(trifluoromethyl)hexa-2,4-dienamide.
| Compound Name | (2Z,4Z)-2-(3-cyanoanilino)-N-[3-[1-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enyl]phenyl]-4-(trifluoromethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 144916856 |
| Molecular Formula | C27H26F3N3O2S |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | (2Z,4Z)-2-(3-cyanoanilino)-N-[3-[1-hydroxy-2-[(Z)-prop-1-enyl]sulfanylbut-2-enyl]phenyl]-4-(trifluoromethyl)hexa-2,4-dienamide |
| SMILES | CC=C(S/C=C\C)C(O)c1cccc(NC(=O)/C(=C/C(=C/C)C(F)(F)F)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C27H26F3N3O2S/c1-4-13-36-24(6-3)25(34)19-10-8-12-22(15-19)33-26(35)23(16-20(5-2)27(28,29)30)32-21-11-7-9-18(14-21)17-31/h4-16,25,32,34H,1-3H3,(H,33,35)/b13-4-,20-5-,23-16-,24-6? |
| InChIKey | TTXLVMVBDYYQNI-KBRIZNGASA-N |
| XLogP | 7.21 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|