C25H18ClF3N4O2 — CID 162618302
4-amino-N-[3-[(4-chlorophenyl)-hydroxymethyl]phenyl]-2-(3-cyanophenyl)imino-5,5,5-trifluoropent-3-enamide (PubChem CID 162618302) has the molecular formula C25H18ClF3N4O2 and a molecular weight of 498.89 g/mol. Its IUPAC name is 4-amino-N-[3-[(4-chlorophenyl)-hydroxymethyl]phenyl]-2-(3-cyanophenyl)imino-5,5,5-trifluoropent-3-enamide.
| Compound Name | 4-amino-N-[3-[(4-chlorophenyl)-hydroxymethyl]phenyl]-2-(3-cyanophenyl)imino-5,5,5-trifluoropent-3-enamide |
|---|---|
| PubChem CID | 162618302 |
| Molecular Formula | C25H18ClF3N4O2 |
| Molecular Weight | 498.89 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 4-amino-N-[3-[(4-chlorophenyl)-hydroxymethyl]phenyl]-2-(3-cyanophenyl)imino-5,5,5-trifluoropent-3-enamide |
| SMILES | N#Cc1cccc(/N=C(\C=C(N)C(F)(F)F)C(=O)Nc2cccc(C(O)c3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C25H18ClF3N4O2/c26-18-9-7-16(8-10-18)23(34)17-4-2-6-20(12-17)33-24(35)21(13-22(31)25(27,28)29)32-19-5-1-3-15(11-19)14-30/h1-13,23,34H,31H2,(H,33,35)/b22-13?,32-21+ |
| InChIKey | QCKVZAPLGXIFNN-AWDRSJIHSA-N |
| XLogP | 5.41 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|