C25H19F3N4O2 — CID 162594976
4-amino-2-(3-cyanophenyl)imino-5,5,5-trifluoro-N-[3-[hydroxy(phenyl)methyl]phenyl]pent-3-enamide (PubChem CID 162594976) has the molecular formula C25H19F3N4O2 and a molecular weight of 464.45 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)imino-5,5,5-trifluoro-N-[3-[hydroxy(phenyl)methyl]phenyl]pent-3-enamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)imino-5,5,5-trifluoro-N-[3-[hydroxy(phenyl)methyl]phenyl]pent-3-enamide |
|---|---|
| PubChem CID | 162594976 |
| Molecular Formula | C25H19F3N4O2 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)imino-5,5,5-trifluoro-N-[3-[hydroxy(phenyl)methyl]phenyl]pent-3-enamide |
| SMILES | N#Cc1cccc(/N=C(\C=C(N)C(F)(F)F)C(=O)Nc2cccc(C(O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H19F3N4O2/c26-25(27,28)22(30)14-21(31-19-10-4-6-16(12-19)15-29)24(34)32-20-11-5-9-18(13-20)23(33)17-7-2-1-3-8-17/h1-14,23,33H,30H2,(H,32,34)/b22-14?,31-21+ |
| InChIKey | CYQLSYWLDSWIKI-IWPXOVLVSA-N |
| XLogP | 4.76 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|