C13H9F3N2O2 — CID 144916604
(2Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienoic acid (PubChem CID 144916604) has the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is (2Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienoic acid.
| Compound Name | (2Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144916604 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | (2Z)-2-(3-cyanoanilino)-4-(trifluoromethyl)penta-2,4-dienoic acid |
| SMILES | C=C(/C=C(\Nc1cccc(C#N)c1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C13H9F3N2O2/c1-8(13(14,15)16)5-11(12(19)20)18-10-4-2-3-9(6-10)7-17/h2-6,18H,1H2,(H,19,20)/b11-5- |
| InChIKey | ZHBNKHCTLFGMNJ-WZUFQYTHSA-N |
| XLogP | 3.06 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|