C17H16F3N3O — CID 144916247
(2Z,4Z)-2-(3-cyanoanilino)-N-ethenyl-4-(trifluoromethyl)hepta-2,4-dienamide (PubChem CID 144916247) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is (2Z,4Z)-2-(3-cyanoanilino)-N-ethenyl-4-(trifluoromethyl)hepta-2,4-dienamide.
| Compound Name | (2Z,4Z)-2-(3-cyanoanilino)-N-ethenyl-4-(trifluoromethyl)hepta-2,4-dienamide |
|---|---|
| PubChem CID | 144916247 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (2Z,4Z)-2-(3-cyanoanilino)-N-ethenyl-4-(trifluoromethyl)hepta-2,4-dienamide |
| SMILES | C=CNC(=O)/C(=C/C(=C/CC)C(F)(F)F)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H16F3N3O/c1-3-6-13(17(18,19)20)10-15(16(24)22-4-2)23-14-8-5-7-12(9-14)11-21/h4-10,23H,2-3H2,1H3,(H,22,24)/b13-6-,15-10- |
| InChIKey | QPDRWOQNTOYBRD-ZVQULJQWSA-N |
| XLogP | 4.01 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|